C22H28O2S — CID 102376307
(Z,2S,5R)-3-(4-methylphenyl)sulfinyl-2-phenylnon-3-en-5-ol (PubChem CID 102376307) has the molecular formula C22H28O2S and a molecular weight of 356.53 g/mol. Its IUPAC name is (Z,2S,5R)-3-(4-methylphenyl)sulfinyl-2-phenylnon-3-en-5-ol.
| Compound Name | (Z,2S,5R)-3-(4-methylphenyl)sulfinyl-2-phenylnon-3-en-5-ol |
|---|---|
| PubChem CID | 102376307 |
| Molecular Formula | C22H28O2S |
| Molecular Weight | 356.53 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | (Z,2S,5R)-3-(4-methylphenyl)sulfinyl-2-phenylnon-3-en-5-ol |
| SMILES | CCCC[C@@H](O)/C=C(/[C@@H](C)c1ccccc1)S(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H28O2S/c1-4-5-11-20(23)16-22(18(3)19-9-7-6-8-10-19)25(24)21-14-12-17(2)13-15-21/h6-10,12-16,18,20,23H,4-5,11H2,1-3H3/b22-16-/t18-,20+,25?/m0/s1 |
| InChIKey | MOSAAXNOQUNYBX-UXFUFBLOSA-N |
| XLogP | 5.34 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.53 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |