C22H26O2S — CID 11256752
(3R)-3-[(Z)-1-[(S)-(4-methylphenyl)sulfinyl]-2-phenylethenyl]heptanal (PubChem CID 11256752) has the molecular formula C22H26O2S and a molecular weight of 354.52 g/mol. Its IUPAC name is (3R)-3-[(Z)-1-[(S)-(4-methylphenyl)sulfinyl]-2-phenylethenyl]heptanal.
| Compound Name | (3R)-3-[(Z)-1-[(S)-(4-methylphenyl)sulfinyl]-2-phenylethenyl]heptanal |
|---|---|
| PubChem CID | 11256752 |
| Molecular Formula | C22H26O2S |
| Molecular Weight | 354.52 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | (3R)-3-[(Z)-1-[(S)-(4-methylphenyl)sulfinyl]-2-phenylethenyl]heptanal |
| SMILES | CCCCC(CC=O)/C(=C/c1ccccc1)[S@@](=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H26O2S/c1-3-4-10-20(15-16-23)22(17-19-8-6-5-7-9-19)25(24)21-13-11-18(2)12-14-21/h5-9,11-14,16-17,20H,3-4,10,15H2,1-2H3/b22-17-/t20?,25-/m0/s1 |
| InChIKey | YLDWRMUGOXIGDV-QQADEIJQSA-N |
| XLogP | 5.54 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.52 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|