C19H22OS — CID 14815272
1-methyl-4-[(E,2S)-2-phenylhex-3-en-3-yl]sulfinylbenzene (PubChem CID 14815272) has the molecular formula C19H22OS and a molecular weight of 298.45 g/mol. Its IUPAC name is 1-methyl-4-[(E,2S)-2-phenylhex-3-en-3-yl]sulfinylbenzene.
| Compound Name | 1-methyl-4-[(E,2S)-2-phenylhex-3-en-3-yl]sulfinylbenzene |
|---|---|
| PubChem CID | 14815272 |
| Molecular Formula | C19H22OS |
| Molecular Weight | 298.45 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 1-methyl-4-[(E,2S)-2-phenylhex-3-en-3-yl]sulfinylbenzene |
| SMILES | CC/C=C(\[C@@H](C)c1ccccc1)S(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H22OS/c1-4-8-19(16(3)17-9-6-5-7-10-17)21(20)18-13-11-15(2)12-14-18/h5-14,16H,4H2,1-3H3/b19-8+/t16-,21?/m0/s1 |
| InChIKey | ASAZVIHHQREMOH-ZMXFDHQFSA-N |
| XLogP | 5.20 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.45 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |