C14H18O2S — CID 177438226
(3S,4E)-4-(4-methylphenyl)sulfinylhepta-4,6-dien-3-ol (PubChem CID 177438226) has the molecular formula C14H18O2S and a molecular weight of 250.36 g/mol. Its IUPAC name is (3S,4E)-4-(4-methylphenyl)sulfinylhepta-4,6-dien-3-ol.
| Compound Name | (3S,4E)-4-(4-methylphenyl)sulfinylhepta-4,6-dien-3-ol |
|---|---|
| PubChem CID | 177438226 |
| Molecular Formula | C14H18O2S |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | (3S,4E)-4-(4-methylphenyl)sulfinylhepta-4,6-dien-3-ol |
| SMILES | C=C/C=C(\[C@@H](O)CC)S(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C14H18O2S/c1-4-6-14(13(15)5-2)17(16)12-9-7-11(3)8-10-12/h4,6-10,13,15H,1,5H2,2-3H3/b14-6+/t13-,17?/m0/s1 |
| InChIKey | XCDOPCHIFDFEJG-DDGSCOSMSA-N |
| XLogP | 2.94 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|