C15H18O2S — CID 177427173
(2E,4S,5E)-5-(4-methylphenyl)sulfinylocta-2,5,7-trien-4-ol (PubChem CID 177427173) has the molecular formula C15H18O2S and a molecular weight of 262.37 g/mol. Its IUPAC name is (2E,4S,5E)-5-(4-methylphenyl)sulfinylocta-2,5,7-trien-4-ol.
| Compound Name | (2E,4S,5E)-5-(4-methylphenyl)sulfinylocta-2,5,7-trien-4-ol |
|---|---|
| PubChem CID | 177427173 |
| Molecular Formula | C15H18O2S |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | (2E,4S,5E)-5-(4-methylphenyl)sulfinylocta-2,5,7-trien-4-ol |
| SMILES | C=C/C=C(\[C@@H](O)/C=C/C)S(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C15H18O2S/c1-4-6-14(16)15(7-5-2)18(17)13-10-8-12(3)9-11-13/h4-11,14,16H,2H2,1,3H3/b6-4+,15-7+/t14-,18?/m0/s1 |
| InChIKey | PASFFLJOBJVHNQ-YLFVQQBCSA-N |
| XLogP | 3.11 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|