C12H13ClOS — CID 101380718
1-[(1Z)-1-chloro-2-methylbuta-1,3-dienyl]sulfinyl-4-methylbenzene (PubChem CID 101380718) has the molecular formula C12H13ClOS and a molecular weight of 240.75 g/mol. Its IUPAC name is 1-[(1Z)-1-chloro-2-methylbuta-1,3-dienyl]sulfinyl-4-methylbenzene.
| Compound Name | 1-[(1Z)-1-chloro-2-methylbuta-1,3-dienyl]sulfinyl-4-methylbenzene |
|---|---|
| PubChem CID | 101380718 |
| Molecular Formula | C12H13ClOS |
| Molecular Weight | 240.75 g/mol |
| Exact Mass | 240.04 |
| IUPAC Name | 1-[(1Z)-1-chloro-2-methylbuta-1,3-dienyl]sulfinyl-4-methylbenzene |
| SMILES | C=C/C(C)=C(\Cl)S(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C12H13ClOS/c1-4-10(3)12(13)15(14)11-7-5-9(2)6-8-11/h4-8H,1H2,2-3H3/b12-10+ |
| InChIKey | XNSDIHYNWBYEET-ZRDIBKRKSA-N |
| XLogP | 3.76 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.75 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|