C17H22O5S — CID 11046026
dimethyl 2-[(Z,2S)-3-[(S)-(4-methylphenyl)sulfinyl]pent-3-en-2-yl]propanedioate (PubChem CID 11046026) has the molecular formula C17H22O5S and a molecular weight of 338.43 g/mol. Its IUPAC name is dimethyl 2-[(Z,2S)-3-[(S)-(4-methylphenyl)sulfinyl]pent-3-en-2-yl]propanedioate.
| Compound Name | dimethyl 2-[(Z,2S)-3-[(S)-(4-methylphenyl)sulfinyl]pent-3-en-2-yl]propanedioate |
|---|---|
| PubChem CID | 11046026 |
| Molecular Formula | C17H22O5S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | dimethyl 2-[(Z,2S)-3-[(S)-(4-methylphenyl)sulfinyl]pent-3-en-2-yl]propanedioate |
| SMILES | C/C=C(/[C@@H](C)C(C(=O)OC)C(=O)OC)[S@@](=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H22O5S/c1-6-14(23(20)13-9-7-11(2)8-10-13)12(3)15(16(18)21-4)17(19)22-5/h6-10,12,15H,1-5H3/b14-6-/t12-,23+/m1/s1 |
| InChIKey | UUOFYAWBQUHXPO-ZWORWPAQSA-N |
| XLogP | 2.60 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|