C15H20O3S — CID 11369510
methyl (E,2S)-2-methyl-2-[(S)-(4-methylphenyl)sulfinyl]hex-4-enoate (PubChem CID 11369510) has the molecular formula C15H20O3S and a molecular weight of 280.39 g/mol. Its IUPAC name is methyl (E,2S)-2-methyl-2-[(S)-(4-methylphenyl)sulfinyl]hex-4-enoate.
| Compound Name | methyl (E,2S)-2-methyl-2-[(S)-(4-methylphenyl)sulfinyl]hex-4-enoate |
|---|---|
| PubChem CID | 11369510 |
| Molecular Formula | C15H20O3S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | methyl (E,2S)-2-methyl-2-[(S)-(4-methylphenyl)sulfinyl]hex-4-enoate |
| SMILES | C/C=C/C[C@@](C)(C(=O)OC)[S@@](=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C15H20O3S/c1-5-6-11-15(3,14(16)18-4)19(17)13-9-7-12(2)8-10-13/h5-10H,11H2,1-4H3/b6-5+/t15-,19-/m0/s1 |
| InChIKey | FHQPIPWMBPQYBX-IDVWOMCOSA-N |
| XLogP | 3.00 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|