C17H28O3SSi — CID 10545140
methyl (2S,4R)-2-methyl-4-[(R)-(4-methylphenyl)sulfinyl]-5-trimethylsilylpentanoate (PubChem CID 10545140) has the molecular formula C17H28O3SSi and a molecular weight of 340.56 g/mol. Its IUPAC name is methyl (2S,4R)-2-methyl-4-[(R)-(4-methylphenyl)sulfinyl]-5-trimethylsilylpentanoate.
| Compound Name | methyl (2S,4R)-2-methyl-4-[(R)-(4-methylphenyl)sulfinyl]-5-trimethylsilylpentanoate |
|---|---|
| PubChem CID | 10545140 |
| Molecular Formula | C17H28O3SSi |
| Molecular Weight | 340.56 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | methyl (2S,4R)-2-methyl-4-[(R)-(4-methylphenyl)sulfinyl]-5-trimethylsilylpentanoate |
| SMILES | COC(=O)[C@@H](C)C[C@H](C[Si](C)(C)C)[S@@](=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H28O3SSi/c1-13-7-9-15(10-8-13)21(19)16(12-22(4,5)6)11-14(2)17(18)20-3/h7-10,14,16H,11-12H2,1-6H3/t14-,16+,21-/m0/s1 |
| InChIKey | WMINDJQMYZJQKM-PXARDIRTSA-N |
| XLogP | 4.01 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.56 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|