C29H34O4SSi — CID 10529595
methyl (2R,3R,4R)-2-benzoyl-4-[(R)-(4-methylphenyl)sulfinyl]-3-phenyl-5-trimethylsilylpentanoate (PubChem CID 10529595) has the molecular formula C29H34O4SSi and a molecular weight of 506.74 g/mol. Its IUPAC name is methyl (2R,3R,4R)-2-benzoyl-4-[(R)-(4-methylphenyl)sulfinyl]-3-phenyl-5-trimethylsilylpentanoate.
| Compound Name | methyl (2R,3R,4R)-2-benzoyl-4-[(R)-(4-methylphenyl)sulfinyl]-3-phenyl-5-trimethylsilylpentanoate |
|---|---|
| PubChem CID | 10529595 |
| Molecular Formula | C29H34O4SSi |
| Molecular Weight | 506.74 g/mol |
| Exact Mass | 506.19 |
| IUPAC Name | methyl (2R,3R,4R)-2-benzoyl-4-[(R)-(4-methylphenyl)sulfinyl]-3-phenyl-5-trimethylsilylpentanoate |
| SMILES | COC(=O)[C@@H](C(=O)c1ccccc1)[C@H](c1ccccc1)[C@H](C[Si](C)(C)C)[S@@](=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C29H34O4SSi/c1-21-16-18-24(19-17-21)34(32)25(20-35(3,4)5)26(22-12-8-6-9-13-22)27(29(31)33-2)28(30)23-14-10-7-11-15-23/h6-19,25-27H,20H2,1-5H3/t25-,26+,27+,34-/m0/s1 |
| InChIKey | VKNUGUQNXZJRNG-DOKVQHETSA-N |
| XLogP | 6.27 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.74 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|