C20H16O2S — CID 11131014
2-(benzenesulfinyl)-1,2-diphenylethanone (PubChem CID 11131014) has the molecular formula C20H16O2S and a molecular weight of 320.41 g/mol. Its IUPAC name is 2-(benzenesulfinyl)-1,2-diphenylethanone.
| Compound Name | 2-(benzenesulfinyl)-1,2-diphenylethanone |
|---|---|
| PubChem CID | 11131014 |
| Molecular Formula | C20H16O2S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 2-(benzenesulfinyl)-1,2-diphenylethanone |
| SMILES | O=C(c1ccccc1)C(c1ccccc1)S(=O)c1ccccc1 |
| InChI | InChI=1S/C20H16O2S/c21-19(16-10-4-1-5-11-16)20(17-12-6-2-7-13-17)23(22)18-14-8-3-9-15-18/h1-15,20H |
| InChIKey | ZVPQEJRSCMJDFW-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |