C17H20BrNO — CID 87920507
trimethyl-(2-oxo-1,2-diphenylethyl)azanium bromide (PubChem CID 87920507) has the molecular formula C17H20BrNO and a molecular weight of 334.26 g/mol. Its IUPAC name is trimethyl-(2-oxo-1,2-diphenylethyl)azanium bromide.
| Compound Name | trimethyl-(2-oxo-1,2-diphenylethyl)azanium bromide |
|---|---|
| PubChem CID | 87920507 |
| Molecular Formula | C17H20BrNO |
| Molecular Weight | 334.26 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | trimethyl-(2-oxo-1,2-diphenylethyl)azanium bromide |
| SMILES | C[N+](C)(C)C(C(=O)c1ccccc1)c1ccccc1.[Br-] |
| InChI | InChI=1S/C17H20NO.BrH/c1-18(2,3)16(14-10-6-4-7-11-14)17(19)15-12-8-5-9-13-15;/h4-13,16H,1-3H3;1H/q+1;/p-1 |
| InChIKey | RWPXEMCFPJJBRF-UHFFFAOYSA-M |
| XLogP | 0.32 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.26 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|