C20H23NO — CID 10637492
(2R,3S)-2-methyl-1,3-diphenyl-3-pyrrolidin-1-ylpropan-1-one (PubChem CID 10637492) has the molecular formula C20H23NO and a molecular weight of 293.41 g/mol. Its IUPAC name is (2R,3S)-2-methyl-1,3-diphenyl-3-pyrrolidin-1-ylpropan-1-one.
| Compound Name | (2R,3S)-2-methyl-1,3-diphenyl-3-pyrrolidin-1-ylpropan-1-one |
|---|---|
| PubChem CID | 10637492 |
| Molecular Formula | C20H23NO |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | (2R,3S)-2-methyl-1,3-diphenyl-3-pyrrolidin-1-ylpropan-1-one |
| SMILES | C[C@@H](C(=O)c1ccccc1)[C@@H](c1ccccc1)N1CCCC1 |
| InChI | InChI=1S/C20H23NO/c1-16(20(22)18-12-6-3-7-13-18)19(21-14-8-9-15-21)17-10-4-2-5-11-17/h2-7,10-13,16,19H,8-9,14-15H2,1H3/t16-,19+/m1/s1 |
| InChIKey | PJCALPLYDLGSCM-APWZRJJASA-N |
| XLogP | 4.34 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |