C26H34N2O — CID 54364623
2-methyl-1,3-diphenyl-2,3-di(piperidin-1-yl)propan-1-one (PubChem CID 54364623) has the molecular formula C26H34N2O and a molecular weight of 390.57 g/mol. Its IUPAC name is 2-methyl-1,3-diphenyl-2,3-di(piperidin-1-yl)propan-1-one.
| Compound Name | 2-methyl-1,3-diphenyl-2,3-di(piperidin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 54364623 |
| Molecular Formula | C26H34N2O |
| Molecular Weight | 390.57 g/mol |
| Exact Mass | 390.27 |
| IUPAC Name | 2-methyl-1,3-diphenyl-2,3-di(piperidin-1-yl)propan-1-one |
| SMILES | CC(C(=O)c1ccccc1)(C(c1ccccc1)N1CCCCC1)N1CCCCC1 |
| InChI | InChI=1S/C26H34N2O/c1-26(28-20-12-5-13-21-28,25(29)23-16-8-3-9-17-23)24(22-14-6-2-7-15-22)27-18-10-4-11-19-27/h2-3,6-9,14-17,24H,4-5,10-13,18-21H2,1H3 |
| InChIKey | UOXJNYUGVYWTFX-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.57 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |