C15H23N — CID 59470641
1-[(1S)-2,2-dimethyl-1-phenylpropyl]pyrrolidine (PubChem CID 59470641) has the molecular formula C15H23N and a molecular weight of 217.36 g/mol. Its IUPAC name is 1-[(1S)-2,2-dimethyl-1-phenylpropyl]pyrrolidine.
| Compound Name | 1-[(1S)-2,2-dimethyl-1-phenylpropyl]pyrrolidine |
|---|---|
| PubChem CID | 59470641 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | 1-[(1S)-2,2-dimethyl-1-phenylpropyl]pyrrolidine |
| SMILES | CC(C)(C)[C@@H](c1ccccc1)N1CCCC1 |
| InChI | InChI=1S/C15H23N/c1-15(2,3)14(16-11-7-8-12-16)13-9-5-4-6-10-13/h4-6,9-10,14H,7-8,11-12H2,1-3H3/t14-/m1/s1 |
| InChIKey | LKDLCIYRUWICSL-CQSZACIVSA-N |
| XLogP | 3.87 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |