C15H23NS — CID 23249782
(1R,2S)-3-methyl-1-phenyl-2-pyrrolidin-1-ylbutane-1-thiol (PubChem CID 23249782) has the molecular formula C15H23NS and a molecular weight of 249.42 g/mol. Its IUPAC name is (1R,2S)-3-methyl-1-phenyl-2-pyrrolidin-1-ylbutane-1-thiol.
| Compound Name | (1R,2S)-3-methyl-1-phenyl-2-pyrrolidin-1-ylbutane-1-thiol |
|---|---|
| PubChem CID | 23249782 |
| Molecular Formula | C15H23NS |
| Molecular Weight | 249.42 g/mol |
| Exact Mass | 249.16 |
| IUPAC Name | (1R,2S)-3-methyl-1-phenyl-2-pyrrolidin-1-ylbutane-1-thiol |
| SMILES | CC(C)[C@@H]([C@H](S)c1ccccc1)N1CCCC1 |
| InChI | InChI=1S/C15H23NS/c1-12(2)14(16-10-6-7-11-16)15(17)13-8-4-3-5-9-13/h3-5,8-9,12,14-15,17H,6-7,10-11H2,1-2H3/t14-,15+/m0/s1 |
| InChIKey | MSXWJZQWBJKSKG-LSDHHAIUSA-N |
| XLogP | 3.78 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.42 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|