C16H26N2O — CID 62987642
3-methyl-2-(1,4-oxazepan-4-yl)-1-phenylbutan-1-amine (PubChem CID 62987642) has the molecular formula C16H26N2O and a molecular weight of 262.40 g/mol. Its IUPAC name is 3-methyl-2-(1,4-oxazepan-4-yl)-1-phenylbutan-1-amine.
| Compound Name | 3-methyl-2-(1,4-oxazepan-4-yl)-1-phenylbutan-1-amine |
|---|---|
| PubChem CID | 62987642 |
| Molecular Formula | C16H26N2O |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.20 |
| IUPAC Name | 3-methyl-2-(1,4-oxazepan-4-yl)-1-phenylbutan-1-amine |
| SMILES | CC(C)C(C(N)c1ccccc1)N1CCCOCC1 |
| InChI | InChI=1S/C16H26N2O/c1-13(2)16(18-9-6-11-19-12-10-18)15(17)14-7-4-3-5-8-14/h3-5,7-8,13,15-16H,6,9-12,17H2,1-2H3 |
| InChIKey | RRKHKXWQEOMWRV-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |