C15H22N2O3 — CID 101092086
ethyl (2R,3S)-3-amino-2-morpholin-4-yl-3-phenylpropanoate (PubChem CID 101092086) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is ethyl (2R,3S)-3-amino-2-morpholin-4-yl-3-phenylpropanoate.
| Compound Name | ethyl (2R,3S)-3-amino-2-morpholin-4-yl-3-phenylpropanoate |
|---|---|
| PubChem CID | 101092086 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | ethyl (2R,3S)-3-amino-2-morpholin-4-yl-3-phenylpropanoate |
| SMILES | CCOC(=O)[C@@H]([C@@H](N)c1ccccc1)N1CCOCC1 |
| InChI | InChI=1S/C15H22N2O3/c1-2-20-15(18)14(17-8-10-19-11-9-17)13(16)12-6-4-3-5-7-12/h3-7,13-14H,2,8-11,16H2,1H3/t13-,14+/m0/s1 |
| InChIKey | ZZMSNFCGUTYJGF-UONOGXRCSA-N |
| XLogP | 0.95 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |