C21H26N2O4 — CID 101092113
ethyl (2S,3R)-2-(2-hydroxyanilino)-3-morpholin-4-yl-3-phenylpropanoate (PubChem CID 101092113) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is ethyl (2S,3R)-2-(2-hydroxyanilino)-3-morpholin-4-yl-3-phenylpropanoate.
| Compound Name | ethyl (2S,3R)-2-(2-hydroxyanilino)-3-morpholin-4-yl-3-phenylpropanoate |
|---|---|
| PubChem CID | 101092113 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | ethyl (2S,3R)-2-(2-hydroxyanilino)-3-morpholin-4-yl-3-phenylpropanoate |
| SMILES | CCOC(=O)[C@@H](Nc1ccccc1O)[C@@H](c1ccccc1)N1CCOCC1 |
| InChI | InChI=1S/C21H26N2O4/c1-2-27-21(25)19(22-17-10-6-7-11-18(17)24)20(16-8-4-3-5-9-16)23-12-14-26-15-13-23/h3-11,19-20,22,24H,2,12-15H2,1H3/t19-,20+/m0/s1 |
| InChIKey | CERSOKXBTFKMPR-VQTJNVASSA-N |
| XLogP | 2.81 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|