C17H22N2O2 — CID 146098369
N-(1-morpholin-4-yl-1-phenylpropan-2-yl)but-2-ynamide (PubChem CID 146098369) has the molecular formula C17H22N2O2 and a molecular weight of 286.38 g/mol. Its IUPAC name is N-(1-morpholin-4-yl-1-phenylpropan-2-yl)but-2-ynamide.
| Compound Name | N-(1-morpholin-4-yl-1-phenylpropan-2-yl)but-2-ynamide |
|---|---|
| PubChem CID | 146098369 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | N-(1-morpholin-4-yl-1-phenylpropan-2-yl)but-2-ynamide |
| SMILES | CC#CC(=O)NC(C)C(c1ccccc1)N1CCOCC1 |
| InChI | InChI=1S/C17H22N2O2/c1-3-7-16(20)18-14(2)17(15-8-5-4-6-9-15)19-10-12-21-13-11-19/h4-6,8-9,14,17H,10-13H2,1-2H3,(H,18,20) |
| InChIKey | YHLFWYCUNREDDP-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|