C21H24N4O2 — CID 51934898
1-(4-cyanophenyl)-3-[(1R,2S)-1-morpholin-4-yl-1-phenylpropan-2-yl]urea (PubChem CID 51934898) has the molecular formula C21H24N4O2 and a molecular weight of 364.45 g/mol. Its IUPAC name is 1-(4-cyanophenyl)-3-[(1R,2S)-1-morpholin-4-yl-1-phenylpropan-2-yl]urea.
| Compound Name | 1-(4-cyanophenyl)-3-[(1R,2S)-1-morpholin-4-yl-1-phenylpropan-2-yl]urea |
|---|---|
| PubChem CID | 51934898 |
| Molecular Formula | C21H24N4O2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 1-(4-cyanophenyl)-3-[(1R,2S)-1-morpholin-4-yl-1-phenylpropan-2-yl]urea |
| SMILES | C[C@H](NC(=O)Nc1ccc(C#N)cc1)[C@@H](c1ccccc1)N1CCOCC1 |
| InChI | InChI=1S/C21H24N4O2/c1-16(23-21(26)24-19-9-7-17(15-22)8-10-19)20(18-5-3-2-4-6-18)25-11-13-27-14-12-25/h2-10,16,20H,11-14H2,1H3,(H2,23,24,26)/t16-,20-/m0/s1 |
| InChIKey | NRRZKJSQDNKPTL-JXFKEZNVSA-N |
| XLogP | 3.14 |
| TPSA | 77.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |