C20H23FN2O2 — CID 2328047
2-fluoro-N-[(1R,2R)-1-morpholin-4-yl-1-phenylpropan-2-yl]benzamide (PubChem CID 2328047) has the molecular formula C20H23FN2O2 and a molecular weight of 342.41 g/mol. Its IUPAC name is 2-fluoro-N-[(1R,2R)-1-morpholin-4-yl-1-phenylpropan-2-yl]benzamide.
| Compound Name | 2-fluoro-N-[(1R,2R)-1-morpholin-4-yl-1-phenylpropan-2-yl]benzamide |
|---|---|
| PubChem CID | 2328047 |
| Molecular Formula | C20H23FN2O2 |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 2-fluoro-N-[(1R,2R)-1-morpholin-4-yl-1-phenylpropan-2-yl]benzamide |
| SMILES | C[C@@H](NC(=O)c1ccccc1F)[C@@H](c1ccccc1)N1CCOCC1 |
| InChI | InChI=1S/C20H23FN2O2/c1-15(22-20(24)17-9-5-6-10-18(17)21)19(16-7-3-2-4-8-16)23-11-13-25-14-12-23/h2-10,15,19H,11-14H2,1H3,(H,22,24)/t15-,19+/m1/s1 |
| InChIKey | HOHCLYNYCQSZHN-BEFAXECRSA-N |
| XLogP | 3.02 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |