C28H42N2O4 — CID 12990897
7,16-bis[(1R)-1-phenylethyl]-1,4,10,13-tetraoxa-7,16-diazacyclooctadecane (PubChem CID 12990897) has the molecular formula C28H42N2O4 and a molecular weight of 470.65 g/mol. Its IUPAC name is 7,16-bis[(1R)-1-phenylethyl]-1,4,10,13-tetraoxa-7,16-diazacyclooctadecane.
| Compound Name | 7,16-bis[(1R)-1-phenylethyl]-1,4,10,13-tetraoxa-7,16-diazacyclooctadecane |
|---|---|
| PubChem CID | 12990897 |
| Molecular Formula | C28H42N2O4 |
| Molecular Weight | 470.65 g/mol |
| Exact Mass | 470.31 |
| IUPAC Name | 7,16-bis[(1R)-1-phenylethyl]-1,4,10,13-tetraoxa-7,16-diazacyclooctadecane |
| SMILES | C[C@H](c1ccccc1)N1CCOCCOCCN([C@H](C)c2ccccc2)CCOCCOCC1 |
| InChI | InChI=1S/C28H42N2O4/c1-25(27-9-5-3-6-10-27)29-13-17-31-21-23-33-19-15-30(16-20-34-24-22-32-18-14-29)26(2)28-11-7-4-8-12-28/h3-12,25-26H,13-24H2,1-2H3/t25-,26-/m1/s1 |
| InChIKey | SROTTXWANKCWEB-CLJLJLNGSA-N |
| XLogP | 4.19 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.65 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |