C19H24N2O — CID 125442567
4-[(1R)-1-[4-(2,6-dimethyl-4-pyridinyl)phenyl]ethyl]morpholine (PubChem CID 125442567) has the molecular formula C19H24N2O and a molecular weight of 296.41 g/mol. Its IUPAC name is 4-[(1R)-1-[4-(2,6-dimethyl-4-pyridinyl)phenyl]ethyl]morpholine.
| Compound Name | 4-[(1R)-1-[4-(2,6-dimethyl-4-pyridinyl)phenyl]ethyl]morpholine |
|---|---|
| PubChem CID | 125442567 |
| Molecular Formula | C19H24N2O |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | 4-[(1R)-1-[4-(2,6-dimethyl-4-pyridinyl)phenyl]ethyl]morpholine |
| SMILES | Cc1cc(-c2ccc([C@@H](C)N3CCOCC3)cc2)cc(C)n1 |
| InChI | InChI=1S/C19H24N2O/c1-14-12-19(13-15(2)20-14)18-6-4-17(5-7-18)16(3)21-8-10-22-11-9-21/h4-7,12-13,16H,8-11H2,1-3H3/t16-/m1/s1 |
| InChIKey | PACSFKWHBNQFQN-MRXNPFEDSA-N |
| XLogP | 3.76 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |