C18H23N3O — CID 163314713
4-[1-[4-(4,5-dimethylpyridazin-3-yl)phenyl]ethyl]morpholine (PubChem CID 163314713) has the molecular formula C18H23N3O and a molecular weight of 297.40 g/mol. Its IUPAC name is 4-[1-[4-(4,5-dimethylpyridazin-3-yl)phenyl]ethyl]morpholine.
| Compound Name | 4-[1-[4-(4,5-dimethylpyridazin-3-yl)phenyl]ethyl]morpholine |
|---|---|
| PubChem CID | 163314713 |
| Molecular Formula | C18H23N3O |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | 4-[1-[4-(4,5-dimethylpyridazin-3-yl)phenyl]ethyl]morpholine |
| SMILES | Cc1cnnc(-c2ccc(C(C)N3CCOCC3)cc2)c1C |
| InChI | InChI=1S/C18H23N3O/c1-13-12-19-20-18(14(13)2)17-6-4-16(5-7-17)15(3)21-8-10-22-11-9-21/h4-7,12,15H,8-11H2,1-3H3 |
| InChIKey | ZKSBKIVNKRUXNX-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |