C16H22N4O — CID 126444550
4-[(1S)-1-[4-(2-ethyl-1,2,4-triazol-3-yl)phenyl]ethyl]morpholine (PubChem CID 126444550) has the molecular formula C16H22N4O and a molecular weight of 286.38 g/mol. Its IUPAC name is 4-[(1S)-1-[4-(2-ethyl-1,2,4-triazol-3-yl)phenyl]ethyl]morpholine.
| Compound Name | 4-[(1S)-1-[4-(2-ethyl-1,2,4-triazol-3-yl)phenyl]ethyl]morpholine |
|---|---|
| PubChem CID | 126444550 |
| Molecular Formula | C16H22N4O |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | 4-[(1S)-1-[4-(2-ethyl-1,2,4-triazol-3-yl)phenyl]ethyl]morpholine |
| SMILES | CCn1ncnc1-c1ccc([C@H](C)N2CCOCC2)cc1 |
| InChI | InChI=1S/C16H22N4O/c1-3-20-16(17-12-18-20)15-6-4-14(5-7-15)13(2)19-8-10-21-11-9-19/h4-7,12-13H,3,8-11H2,1-2H3/t13-/m0/s1 |
| InChIKey | ZKFURZSMVKHLRS-ZDUSSCGKSA-N |
| XLogP | 2.36 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |