C12H25NS — CID 135845077
(3S,4S)-2,5-dimethyl-4-pyrrolidin-1-ylhexane-3-thiol (PubChem CID 135845077) has the molecular formula C12H25NS and a molecular weight of 215.41 g/mol. Its IUPAC name is (3S,4S)-2,5-dimethyl-4-pyrrolidin-1-ylhexane-3-thiol.
| Compound Name | (3S,4S)-2,5-dimethyl-4-pyrrolidin-1-ylhexane-3-thiol |
|---|---|
| PubChem CID | 135845077 |
| Molecular Formula | C12H25NS |
| Molecular Weight | 215.41 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | (3S,4S)-2,5-dimethyl-4-pyrrolidin-1-ylhexane-3-thiol |
| SMILES | CC(C)[C@H](S)[C@H](C(C)C)N1CCCC1 |
| InChI | InChI=1S/C12H25NS/c1-9(2)11(12(14)10(3)4)13-7-5-6-8-13/h9-12,14H,5-8H2,1-4H3/t11-,12-/m0/s1 |
| InChIKey | DDIXIYJGZPSORL-RYUDHWBXSA-N |
| XLogP | 3.06 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.41 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|