C22H24O5S — CID 10092393
methyl 2-acetyl-4-[(R)-(4-methylphenyl)sulfinyl]-5-oxo-3-phenylhexanoate (PubChem CID 10092393) has the molecular formula C22H24O5S and a molecular weight of 400.50 g/mol. Its IUPAC name is methyl 2-acetyl-4-[(R)-(4-methylphenyl)sulfinyl]-5-oxo-3-phenylhexanoate.
| Compound Name | methyl 2-acetyl-4-[(R)-(4-methylphenyl)sulfinyl]-5-oxo-3-phenylhexanoate |
|---|---|
| PubChem CID | 10092393 |
| Molecular Formula | C22H24O5S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | methyl 2-acetyl-4-[(R)-(4-methylphenyl)sulfinyl]-5-oxo-3-phenylhexanoate |
| SMILES | COC(=O)C(C(C)=O)C(c1ccccc1)C(C(C)=O)[S@@](=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H24O5S/c1-14-10-12-18(13-11-14)28(26)21(16(3)24)20(17-8-6-5-7-9-17)19(15(2)23)22(25)27-4/h5-13,19-21H,1-4H3/t19?,20?,21?,28-/m0/s1 |
| InChIKey | OVYALAXVFPEDGV-YWYCCQMSSA-N |
| XLogP | 3.22 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|