C29H36O3SSi — CID 10743760
methyl (2S,3R,4R)-2-benzyl-4-[(R)-(4-methylphenyl)sulfinyl]-3-phenyl-5-trimethylsilylpentanoate (PubChem CID 10743760) has the molecular formula C29H36O3SSi and a molecular weight of 492.76 g/mol. Its IUPAC name is methyl (2S,3R,4R)-2-benzyl-4-[(R)-(4-methylphenyl)sulfinyl]-3-phenyl-5-trimethylsilylpentanoate.
| Compound Name | methyl (2S,3R,4R)-2-benzyl-4-[(R)-(4-methylphenyl)sulfinyl]-3-phenyl-5-trimethylsilylpentanoate |
|---|---|
| PubChem CID | 10743760 |
| Molecular Formula | C29H36O3SSi |
| Molecular Weight | 492.76 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | methyl (2S,3R,4R)-2-benzyl-4-[(R)-(4-methylphenyl)sulfinyl]-3-phenyl-5-trimethylsilylpentanoate |
| SMILES | COC(=O)[C@@H](Cc1ccccc1)[C@H](c1ccccc1)[C@H](C[Si](C)(C)C)[S@@](=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C29H36O3SSi/c1-22-16-18-25(19-17-22)33(31)27(21-34(3,4)5)28(24-14-10-7-11-15-24)26(29(30)32-2)20-23-12-8-6-9-13-23/h6-19,26-28H,20-21H2,1-5H3/t26-,27-,28-,33-/m0/s1 |
| InChIKey | ZLTVKLCXAZPIJT-JIOPRJIZSA-N |
| XLogP | 6.63 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.76 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|