C27H30N2O3 — CID 135836169
methyl (2S,3R)-2-benzyl-4-phenyl-3-[[(1S)-1-phenylethyl]carbamoylamino]butanoate (PubChem CID 135836169) has the molecular formula C27H30N2O3 and a molecular weight of 430.55 g/mol. Its IUPAC name is methyl (2S,3R)-2-benzyl-4-phenyl-3-[[(1S)-1-phenylethyl]carbamoylamino]butanoate.
| Compound Name | methyl (2S,3R)-2-benzyl-4-phenyl-3-[[(1S)-1-phenylethyl]carbamoylamino]butanoate |
|---|---|
| PubChem CID | 135836169 |
| Molecular Formula | C27H30N2O3 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | methyl (2S,3R)-2-benzyl-4-phenyl-3-[[(1S)-1-phenylethyl]carbamoylamino]butanoate |
| SMILES | COC(=O)[C@@H](Cc1ccccc1)[C@@H](Cc1ccccc1)NC(=O)N[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C27H30N2O3/c1-20(23-16-10-5-11-17-23)28-27(31)29-25(19-22-14-8-4-9-15-22)24(26(30)32-2)18-21-12-6-3-7-13-21/h3-17,20,24-25H,18-19H2,1-2H3,(H2,28,29,31)/t20-,24-,25+/m0/s1 |
| InChIKey | RYPSKVSEGJUYPM-KSNOWIBYSA-N |
| XLogP | 4.69 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |