C26H28N2O2 — CID 3756499
2-benzyl-N,N'-bis(1-phenylethyl)propanediamide (PubChem CID 3756499) has the molecular formula C26H28N2O2 and a molecular weight of 400.52 g/mol. Its IUPAC name is 2-benzyl-N,N'-bis(1-phenylethyl)propanediamide.
| Compound Name | 2-benzyl-N,N'-bis(1-phenylethyl)propanediamide |
|---|---|
| PubChem CID | 3756499 |
| Molecular Formula | C26H28N2O2 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | 2-benzyl-N,N'-bis(1-phenylethyl)propanediamide |
| SMILES | CC(NC(=O)C(Cc1ccccc1)C(=O)NC(C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H28N2O2/c1-19(22-14-8-4-9-15-22)27-25(29)24(18-21-12-6-3-7-13-21)26(30)28-20(2)23-16-10-5-11-17-23/h3-17,19-20,24H,18H2,1-2H3,(H,27,29)(H,28,30) |
| InChIKey | ZJWXXRKVVWUDSC-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|