C33H34N4O3 — CID 67122353
2-[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl]-N,N'-bis(1-phenylethyl)propanediamide (PubChem CID 67122353) has the molecular formula C33H34N4O3 and a molecular weight of 534.66 g/mol. Its IUPAC name is 2-[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl]-N,N'-bis(1-phenylethyl)propanediamide.
| Compound Name | 2-[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl]-N,N'-bis(1-phenylethyl)propanediamide |
|---|---|
| PubChem CID | 67122353 |
| Molecular Formula | C33H34N4O3 |
| Molecular Weight | 534.66 g/mol |
| Exact Mass | 534.26 |
| IUPAC Name | 2-[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl]-N,N'-bis(1-phenylethyl)propanediamide |
| SMILES | CC(NC(=O)C(Cc1ccc(C(=O)Nc2ccccc2N)cc1)C(=O)NC(C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H34N4O3/c1-22(25-11-5-3-6-12-25)35-32(39)28(33(40)36-23(2)26-13-7-4-8-14-26)21-24-17-19-27(20-18-24)31(38)37-30-16-10-9-15-29(30)34/h3-20,22-23,28H,21,34H2,1-2H3,(H,35,39)(H,36,40)(H,37,38) |
| InChIKey | OULXATFWEDRUBU-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.66 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|