C9H12N2O2 — CID 50905877
1-hydroxy-3-[(1R)-1-phenylethyl]urea (PubChem CID 50905877) has the molecular formula C9H12N2O2 and a molecular weight of 180.21 g/mol. Its IUPAC name is 1-hydroxy-3-[(1R)-1-phenylethyl]urea.
| Compound Name | 1-hydroxy-3-[(1R)-1-phenylethyl]urea |
|---|---|
| PubChem CID | 50905877 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 1-hydroxy-3-[(1R)-1-phenylethyl]urea |
| SMILES | C[C@@H](NC(=O)NO)c1ccccc1 |
| InChI | InChI=1S/C9H12N2O2/c1-7(10-9(12)11-13)8-5-3-2-4-6-8/h2-7,13H,1H3,(H2,10,11,12)/t7-/m1/s1 |
| InChIKey | RTFKIDYTVUQTTD-SSDOTTSWSA-N |
| XLogP | 1.44 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|