C18H32O2SSi — CID 10569182
(2R)-2-[(R)-(4-methylphenyl)sulfinyl]-1-trimethylsilyloctan-3-ol (PubChem CID 10569182) has the molecular formula C18H32O2SSi and a molecular weight of 340.61 g/mol. Its IUPAC name is (2R)-2-[(R)-(4-methylphenyl)sulfinyl]-1-trimethylsilyloctan-3-ol.
| Compound Name | (2R)-2-[(R)-(4-methylphenyl)sulfinyl]-1-trimethylsilyloctan-3-ol |
|---|---|
| PubChem CID | 10569182 |
| Molecular Formula | C18H32O2SSi |
| Molecular Weight | 340.61 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | (2R)-2-[(R)-(4-methylphenyl)sulfinyl]-1-trimethylsilyloctan-3-ol |
| SMILES | CCCCCC(O)[C@H](C[Si](C)(C)C)[S@@](=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H32O2SSi/c1-6-7-8-9-17(19)18(14-22(3,4)5)21(20)16-12-10-15(2)11-13-16/h10-13,17-19H,6-9,14H2,1-5H3/t17?,18-,21-/m0/s1 |
| InChIKey | PGUIQSUKMNFCSQ-VLQCZPCNSA-N |
| XLogP | 4.75 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.61 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|