About octane;octan-2-ol;bis(1,4-xylene)
octane;octan-2-ol;bis(1,4-xylene) (PubChem CID 161441445) has the molecular formula C32H56O
and a molecular weight of 456.80 g/mol. Its IUPAC name is octane;octan-2-ol;bis(1,4-xylene).
Molecular Properties
| Compound Name | octane;octan-2-ol;bis(1,4-xylene) |
| PubChem CID | 161441445 |
| Molecular Formula | C32H56O |
| Molecular Weight | 456.80 g/mol |
| Exact Mass | 456.43 |
| IUPAC Name | octane;octan-2-ol;bis(1,4-xylene) |
| SMILES | CCCCCCC(C)O.CCCCCCCC.Cc1ccc(C)cc1.Cc1ccc(C)cc1 |
| InChI | InChI=1S/C8H18O.2C8H10.C8H18/c1-3-4-5-6-7-8(2)9;2*1-7-3-5-8(2)6-4-7;1-3-5-7-8-6-4-2/h8-9H,3-7H2,1-2H3;2*3-6H,1-2H3;3-8H2,1-2H3 |
| InChIKey | VZIANTLNXLPBNP-UHFFFAOYSA-N |
| XLogP | 10.31 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 456.80 |
| LogP ≤ 5 | 10.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze octane;octan-2-ol;bis(1,4-xylene) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octane;octan-2-ol;bis(1,4-xylene)?
The IUPAC name of octane;octan-2-ol;bis(1,4-xylene) (CID 161441445) is octane;octan-2-ol;bis(1,4-xylene).
What is the SMILES notation for octane;octan-2-ol;bis(1,4-xylene)?
The canonical SMILES for octane;octan-2-ol;bis(1,4-xylene) is CCCCCCC(C)O.CCCCCCCC.Cc1ccc(C)cc1.Cc1ccc(C)cc1.
What is the InChIKey of octane;octan-2-ol;bis(1,4-xylene)?
The InChIKey is VZIANTLNXLPBNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O.2C8H10.C8H18/c1-3-4-5-6-7-8(2)9;2*1-7-3-5-8(2)6-4-7;1-3-5-7-8-6-4-2/h8-9H,3-7H2,1-2H3;2*3-6H,1-2H3;3-8H2,1-2H3.
What are the key properties of octane;octan-2-ol;bis(1,4-xylene)?
octane;octan-2-ol;bis(1,4-xylene) has a molecular weight of 456.80 g/mol, XLogP of 10.31, 10 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for octane;octan-2-ol;bis(1,4-xylene) is sourced from PubChem (CID 161441445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).