C15H15ClO2S — CID 10613755
(1R,2S)-2-chloro-2-[(R)-(4-methylphenyl)sulfinyl]-1-phenylethanol (PubChem CID 10613755) has the molecular formula C15H15ClO2S and a molecular weight of 294.80 g/mol. Its IUPAC name is (1R,2S)-2-chloro-2-[(R)-(4-methylphenyl)sulfinyl]-1-phenylethanol.
| Compound Name | (1R,2S)-2-chloro-2-[(R)-(4-methylphenyl)sulfinyl]-1-phenylethanol |
|---|---|
| PubChem CID | 10613755 |
| Molecular Formula | C15H15ClO2S |
| Molecular Weight | 294.80 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | (1R,2S)-2-chloro-2-[(R)-(4-methylphenyl)sulfinyl]-1-phenylethanol |
| SMILES | Cc1ccc([S@@](=O)[C@@H](Cl)[C@H](O)c2ccccc2)cc1 |
| InChI | InChI=1S/C15H15ClO2S/c1-11-7-9-13(10-8-11)19(18)15(16)14(17)12-5-3-2-4-6-12/h2-10,14-15,17H,1H3/t14-,15-,19-/m1/s1 |
| InChIKey | FBWWSLOITGPFPX-SPYBWZPUSA-N |
| XLogP | 3.40 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.80 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|