C21H20O2S — CID 102211608
(1R)-2-[2-(4-methylphenyl)sulfinylphenyl]-1-phenylethanol (PubChem CID 102211608) has the molecular formula C21H20O2S and a molecular weight of 336.46 g/mol. Its IUPAC name is (1R)-2-[2-(4-methylphenyl)sulfinylphenyl]-1-phenylethanol.
| Compound Name | (1R)-2-[2-(4-methylphenyl)sulfinylphenyl]-1-phenylethanol |
|---|---|
| PubChem CID | 102211608 |
| Molecular Formula | C21H20O2S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | (1R)-2-[2-(4-methylphenyl)sulfinylphenyl]-1-phenylethanol |
| SMILES | Cc1ccc(S(=O)c2ccccc2C[C@@H](O)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H20O2S/c1-16-11-13-19(14-12-16)24(23)21-10-6-5-9-18(21)15-20(22)17-7-3-2-4-8-17/h2-14,20,22H,15H2,1H3/t20-,24?/m1/s1 |
| InChIKey | XPOBGXCHDJTMMV-CGHJUBPDSA-N |
| XLogP | 4.44 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |