C19H21IO2S — CID 42624545
(3R)-2-iodo-3-[[2-[(R)-(4-methylphenyl)sulfinyl]phenyl]methyl]pent-1-en-3-ol (PubChem CID 42624545) has the molecular formula C19H21IO2S and a molecular weight of 440.35 g/mol. Its IUPAC name is (3R)-2-iodo-3-[[2-[(R)-(4-methylphenyl)sulfinyl]phenyl]methyl]pent-1-en-3-ol.
| Compound Name | (3R)-2-iodo-3-[[2-[(R)-(4-methylphenyl)sulfinyl]phenyl]methyl]pent-1-en-3-ol |
|---|---|
| PubChem CID | 42624545 |
| Molecular Formula | C19H21IO2S |
| Molecular Weight | 440.35 g/mol |
| Exact Mass | 440.03 |
| IUPAC Name | (3R)-2-iodo-3-[[2-[(R)-(4-methylphenyl)sulfinyl]phenyl]methyl]pent-1-en-3-ol |
| SMILES | C=C(I)[C@@](O)(CC)Cc1ccccc1[S@](=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H21IO2S/c1-4-19(21,15(3)20)13-16-7-5-6-8-18(16)23(22)17-11-9-14(2)10-12-17/h5-12,21H,3-4,13H2,1-2H3/t19-,23-/m1/s1 |
| InChIKey | NELKVMGGVBLKRS-AUSIDOKSSA-N |
| XLogP | 4.79 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.35 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|