C26H22O2S2 — CID 59167193
2-[4-[4-(benzenesulfinyl)phenyl]phenyl]sulfinyl-1,4-dimethylbenzene (PubChem CID 59167193) has the molecular formula C26H22O2S2 and a molecular weight of 430.59 g/mol. Its IUPAC name is 2-[4-[4-(benzenesulfinyl)phenyl]phenyl]sulfinyl-1,4-dimethylbenzene.
| Compound Name | 2-[4-[4-(benzenesulfinyl)phenyl]phenyl]sulfinyl-1,4-dimethylbenzene |
|---|---|
| PubChem CID | 59167193 |
| Molecular Formula | C26H22O2S2 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | 2-[4-[4-(benzenesulfinyl)phenyl]phenyl]sulfinyl-1,4-dimethylbenzene |
| SMILES | Cc1ccc(C)c(S(=O)c2ccc(-c3ccc(S(=O)c4ccccc4)cc3)cc2)c1 |
| InChI | InChI=1S/C26H22O2S2/c1-19-8-9-20(2)26(18-19)30(28)25-16-12-22(13-17-25)21-10-14-24(15-11-21)29(27)23-6-4-3-5-7-23/h3-18H,1-2H3 |
| InChIKey | XHSIZBUIHLJMOD-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |