C21H16O2S2 — CID 154642403
2-(2,5-dimethylphenyl)sulfinylthioxanthen-9-one (PubChem CID 154642403) has the molecular formula C21H16O2S2 and a molecular weight of 364.49 g/mol. Its IUPAC name is 2-(2,5-dimethylphenyl)sulfinylthioxanthen-9-one.
| Compound Name | 2-(2,5-dimethylphenyl)sulfinylthioxanthen-9-one |
|---|---|
| PubChem CID | 154642403 |
| Molecular Formula | C21H16O2S2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | 2-(2,5-dimethylphenyl)sulfinylthioxanthen-9-one |
| SMILES | Cc1ccc(C)c(S(=O)c2ccc3sc4ccccc4c(=O)c3c2)c1 |
| InChI | InChI=1S/C21H16O2S2/c1-13-7-8-14(2)20(11-13)25(23)15-9-10-19-17(12-15)21(22)16-5-3-4-6-18(16)24-19/h3-12H,1-2H3 |
| InChIKey | GTBKDNYUHRQSCN-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|