C18H16O2S — CID 125486494
2-hydroxy-3-(2,4,6-trimethylphenyl)thiochromen-4-one (PubChem CID 125486494) has the molecular formula C18H16O2S and a molecular weight of 296.39 g/mol. Its IUPAC name is 2-hydroxy-3-(2,4,6-trimethylphenyl)thiochromen-4-one.
| Compound Name | 2-hydroxy-3-(2,4,6-trimethylphenyl)thiochromen-4-one |
|---|---|
| PubChem CID | 125486494 |
| Molecular Formula | C18H16O2S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 2-hydroxy-3-(2,4,6-trimethylphenyl)thiochromen-4-one |
| SMILES | Cc1cc(C)c(-c2c(O)sc3ccccc3c2=O)c(C)c1 |
| InChI | InChI=1S/C18H16O2S/c1-10-8-11(2)15(12(3)9-10)16-17(19)13-6-4-5-7-14(13)21-18(16)20/h4-9,20H,1-3H3 |
| InChIKey | MTGKBUFVJNQSIR-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |