About 1,3-bis(2,4,6-trimethylphenyl)-2-benzothiophene
1,3-bis(2,4,6-trimethylphenyl)-2-benzothiophene (PubChem CID 14668871) has the molecular formula C26H26S
and a molecular weight of 370.56 g/mol. Its IUPAC name is 1,3-bis(2,4,6-trimethylphenyl)-2-benzothiophene.
Molecular Properties
| Compound Name | 1,3-bis(2,4,6-trimethylphenyl)-2-benzothiophene |
| PubChem CID | 14668871 |
| Molecular Formula | C26H26S |
| Molecular Weight | 370.56 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 1,3-bis(2,4,6-trimethylphenyl)-2-benzothiophene |
| SMILES | Cc1cc(C)c(-c2sc(-c3c(C)cc(C)cc3C)c3ccccc23)c(C)c1 |
| InChI | InChI=1S/C26H26S/c1-15-11-17(3)23(18(4)12-15)25-21-9-7-8-10-22(21)26(27-25)24-19(5)13-16(2)14-20(24)6/h7-14H,1-6H3 |
| InChIKey | ACAKAGIJFZATNH-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.56 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,3-bis(2,4,6-trimethylphenyl)-2-benzothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-bis(2,4,6-trimethylphenyl)-2-benzothiophene?
The IUPAC name of 1,3-bis(2,4,6-trimethylphenyl)-2-benzothiophene (CID 14668871) is 1,3-bis(2,4,6-trimethylphenyl)-2-benzothiophene.
What is the SMILES notation for 1,3-bis(2,4,6-trimethylphenyl)-2-benzothiophene?
The canonical SMILES for 1,3-bis(2,4,6-trimethylphenyl)-2-benzothiophene is Cc1cc(C)c(-c2sc(-c3c(C)cc(C)cc3C)c3ccccc23)c(C)c1.
What is the InChIKey of 1,3-bis(2,4,6-trimethylphenyl)-2-benzothiophene?
The InChIKey is ACAKAGIJFZATNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H26S/c1-15-11-17(3)23(18(4)12-15)25-21-9-7-8-10-22(21)26(27-25)24-19(5)13-16(2)14-20(24)6/h7-14H,1-6H3.
What are the key properties of 1,3-bis(2,4,6-trimethylphenyl)-2-benzothiophene?
1,3-bis(2,4,6-trimethylphenyl)-2-benzothiophene has a molecular weight of 370.56 g/mol, XLogP of 8.09, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-bis(2,4,6-trimethylphenyl)-2-benzothiophene is sourced from PubChem (CID 14668871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).