C26H22N2S — CID 139241039
3,6-diphenyl-2-(2,4,6-trimethylphenyl)imidazo[2,1-b][1,3]thiazole (PubChem CID 139241039) has the molecular formula C26H22N2S and a molecular weight of 394.54 g/mol. Its IUPAC name is 3,6-diphenyl-2-(2,4,6-trimethylphenyl)imidazo[2,1-b][1,3]thiazole.
| Compound Name | 3,6-diphenyl-2-(2,4,6-trimethylphenyl)imidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 139241039 |
| Molecular Formula | C26H22N2S |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 3,6-diphenyl-2-(2,4,6-trimethylphenyl)imidazo[2,1-b][1,3]thiazole |
| SMILES | Cc1cc(C)c(-c2sc3nc(-c4ccccc4)cn3c2-c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C26H22N2S/c1-17-14-18(2)23(19(3)15-17)25-24(21-12-8-5-9-13-21)28-16-22(27-26(28)29-25)20-10-6-4-7-11-20/h4-16H,1-3H3 |
| InChIKey | SMKVXTWQECVSLM-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |