C20H16N4O2S — CID 19164108
N'-benzoyl-3-methyl-6-phenylimidazo[2,1-b][1,3]thiazole-2-carbohydrazide (PubChem CID 19164108) has the molecular formula C20H16N4O2S and a molecular weight of 376.44 g/mol. Its IUPAC name is N'-benzoyl-3-methyl-6-phenylimidazo[2,1-b][1,3]thiazole-2-carbohydrazide.
| Compound Name | N'-benzoyl-3-methyl-6-phenylimidazo[2,1-b][1,3]thiazole-2-carbohydrazide |
|---|---|
| PubChem CID | 19164108 |
| Molecular Formula | C20H16N4O2S |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | N'-benzoyl-3-methyl-6-phenylimidazo[2,1-b][1,3]thiazole-2-carbohydrazide |
| SMILES | Cc1c(C(=O)NNC(=O)c2ccccc2)sc2nc(-c3ccccc3)cn12 |
| InChI | InChI=1S/C20H16N4O2S/c1-13-17(19(26)23-22-18(25)15-10-6-3-7-11-15)27-20-21-16(12-24(13)20)14-8-4-2-5-9-14/h2-12H,1H3,(H,22,25)(H,23,26) |
| InChIKey | DSZMFJURBMZMSG-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 75.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|