C24H23N3O3S — CID 19164146
butyl 4-[(3-methyl-6-phenylimidazo[2,1-b][1,3]thiazole-2-carbonyl)amino]benzoate (PubChem CID 19164146) has the molecular formula C24H23N3O3S and a molecular weight of 433.53 g/mol. Its IUPAC name is butyl 4-[(3-methyl-6-phenylimidazo[2,1-b][1,3]thiazole-2-carbonyl)amino]benzoate.
| Compound Name | butyl 4-[(3-methyl-6-phenylimidazo[2,1-b][1,3]thiazole-2-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 19164146 |
| Molecular Formula | C24H23N3O3S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | butyl 4-[(3-methyl-6-phenylimidazo[2,1-b][1,3]thiazole-2-carbonyl)amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)c2sc3nc(-c4ccccc4)cn3c2C)cc1 |
| InChI | InChI=1S/C24H23N3O3S/c1-3-4-14-30-23(29)18-10-12-19(13-11-18)25-22(28)21-16(2)27-15-20(26-24(27)31-21)17-8-6-5-7-9-17/h5-13,15H,3-4,14H2,1-2H3,(H,25,28) |
| InChIKey | QHJMXEYHUPAJBV-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|