C25H25N3O3S — CID 30939331
butyl 4-[3-(6-phenylimidazo[2,1-b][1,3]thiazol-3-yl)propanoylamino]benzoate (PubChem CID 30939331) has the molecular formula C25H25N3O3S and a molecular weight of 447.56 g/mol. Its IUPAC name is butyl 4-[3-(6-phenylimidazo[2,1-b][1,3]thiazol-3-yl)propanoylamino]benzoate.
| Compound Name | butyl 4-[3-(6-phenylimidazo[2,1-b][1,3]thiazol-3-yl)propanoylamino]benzoate |
|---|---|
| PubChem CID | 30939331 |
| Molecular Formula | C25H25N3O3S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | butyl 4-[3-(6-phenylimidazo[2,1-b][1,3]thiazol-3-yl)propanoylamino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)CCc2csc3nc(-c4ccccc4)cn23)cc1 |
| InChI | InChI=1S/C25H25N3O3S/c1-2-3-15-31-24(30)19-9-11-20(12-10-19)26-23(29)14-13-21-17-32-25-27-22(16-28(21)25)18-7-5-4-6-8-18/h4-12,16-17H,2-3,13-15H2,1H3,(H,26,29) |
| InChIKey | UTKDZZHANMFXCN-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|