C16H11N3O2S — CID 139808441
7-amino-2-phenylimidazo[2,1-b][1,3]benzothiazole-6-carboxylic acid (PubChem CID 139808441) has the molecular formula C16H11N3O2S and a molecular weight of 309.35 g/mol. Its IUPAC name is 7-amino-2-phenylimidazo[2,1-b][1,3]benzothiazole-6-carboxylic acid.
| Compound Name | 7-amino-2-phenylimidazo[2,1-b][1,3]benzothiazole-6-carboxylic acid |
|---|---|
| PubChem CID | 139808441 |
| Molecular Formula | C16H11N3O2S |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | 7-amino-2-phenylimidazo[2,1-b][1,3]benzothiazole-6-carboxylic acid |
| SMILES | Nc1cc2c(cc1C(=O)O)sc1nc(-c3ccccc3)cn12 |
| InChI | InChI=1S/C16H11N3O2S/c17-11-7-13-14(6-10(11)15(20)21)22-16-18-12(8-19(13)16)9-4-2-1-3-5-9/h1-8H,17H2,(H,20,21) |
| InChIKey | IAJUBIABVWBUEA-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 80.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|