C32H20N4O5S3 — CID 13206732
(3-imidazo[2,1-b][1,3]benzothiazol-2-ylphenyl) 2-(3-imidazo[2,1-b][1,3]benzothiazol-2-ylphenoxy)sulfonylacetate (PubChem CID 13206732) has the molecular formula C32H20N4O5S3 and a molecular weight of 636.74 g/mol. Its IUPAC name is (3-imidazo[2,1-b][1,3]benzothiazol-2-ylphenyl) 2-(3-imidazo[2,1-b][1,3]benzothiazol-2-ylphenoxy)sulfonylacetate.
| Compound Name | (3-imidazo[2,1-b][1,3]benzothiazol-2-ylphenyl) 2-(3-imidazo[2,1-b][1,3]benzothiazol-2-ylphenoxy)sulfonylacetate |
|---|---|
| PubChem CID | 13206732 |
| Molecular Formula | C32H20N4O5S3 |
| Molecular Weight | 636.74 g/mol |
| Exact Mass | 636.06 |
| IUPAC Name | (3-imidazo[2,1-b][1,3]benzothiazol-2-ylphenyl) 2-(3-imidazo[2,1-b][1,3]benzothiazol-2-ylphenoxy)sulfonylacetate |
| SMILES | O=C(CS(=O)(=O)Oc1cccc(-c2cn3c(n2)sc2ccccc23)c1)Oc1cccc(-c2cn3c(n2)sc2ccccc23)c1 |
| InChI | InChI=1S/C32H20N4O5S3/c37-30(40-22-9-5-7-20(15-22)24-17-35-26-11-1-3-13-28(26)42-31(35)33-24)19-44(38,39)41-23-10-6-8-21(16-23)25-18-36-27-12-2-4-14-29(27)43-32(36)34-25/h1-18H,19H2 |
| InChIKey | WEOOUODLUXGYPO-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 104.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.74 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|