C13H7N3O3S — CID 139808437
2-(5-nitrofuran-2-yl)imidazo[2,1-b][1,3]benzothiazole (PubChem CID 139808437) has the molecular formula C13H7N3O3S and a molecular weight of 285.28 g/mol. Its IUPAC name is 2-(5-nitrofuran-2-yl)imidazo[2,1-b][1,3]benzothiazole.
| Compound Name | 2-(5-nitrofuran-2-yl)imidazo[2,1-b][1,3]benzothiazole |
|---|---|
| PubChem CID | 139808437 |
| Molecular Formula | C13H7N3O3S |
| Molecular Weight | 285.28 g/mol |
| Exact Mass | 285.02 |
| IUPAC Name | 2-(5-nitrofuran-2-yl)imidazo[2,1-b][1,3]benzothiazole |
| SMILES | O=[N+]([O-])c1ccc(-c2cn3c(n2)sc2ccccc23)o1 |
| InChI | InChI=1S/C13H7N3O3S/c17-16(18)12-6-5-10(19-12)8-7-15-9-3-1-2-4-11(9)20-13(15)14-8/h1-7H |
| InChIKey | QTRDQYVIULHINI-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 73.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.28 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|