C15H10N3O2S- — CID 163145309
N-(4-imidazo[2,1-b][1,3]benzothiazol-2-ylphenyl)-N-oxidohydroxylamine (PubChem CID 163145309) has the molecular formula C15H10N3O2S- and a molecular weight of 296.33 g/mol. Its IUPAC name is N-(4-imidazo[2,1-b][1,3]benzothiazol-2-ylphenyl)-N-oxidohydroxylamine.
| Compound Name | N-(4-imidazo[2,1-b][1,3]benzothiazol-2-ylphenyl)-N-oxidohydroxylamine |
|---|---|
| PubChem CID | 163145309 |
| Molecular Formula | C15H10N3O2S- |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | N-(4-imidazo[2,1-b][1,3]benzothiazol-2-ylphenyl)-N-oxidohydroxylamine |
| SMILES | [O-]N(O)c1ccc(-c2cn3c(n2)sc2ccccc23)cc1 |
| InChI | InChI=1S/C15H10N3O2S/c19-18(20)11-7-5-10(6-8-11)12-9-17-13-3-1-2-4-14(13)21-15(17)16-12/h1-9,19H/q-1 |
| InChIKey | BMZMDUPMJXWQNK-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|